3316-09-4 4-Nitrocatechol
| ürün Ad? |
4-Nitrocatechol |
| ingilizce ad? |
4-Nitrocatechol; 4-nitropyrocatechol; 3,4-Dihydroxynitrobenzene; 2-hydroxy-4-nitrophenolate; 4-nitrobenzene-1,2-diol |
| Moleküler Formülü |
C6H5NO4 |
| Molekül A??rl??? |
155.1082 |
| InChI |
InChI=1/C6H5NO4/c8-5-2-1-4(7(10)11)3-6(5)9/h1-3,8-9H |
| CAS kay?t numaras? |
3316-09-4 |
| EINECS |
222-009-0 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.58g/cm3 |
| Ergime noktas? |
173-177℃ |
| Kaynama noktas? |
358.2°C at 760 mmHg |
| K?r?lma indisi |
1.667 |
| Alevlenme noktas? |
168.8°C |
| Buhar bas?nc? |
1.25E-05mmHg at 25°C |
| Tehlike Sembolleri |
Xi:Irritant;
|
| Risk Kodlar? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik A??klamas? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|