3316-09-4 4-Nitrocatechol
| ??? ?????? |
4-Nitrocatechol |
| ????? ??????????? |
4-Nitrocatechol; 4-nitropyrocatechol; 3,4-Dihydroxynitrobenzene; 2-hydroxy-4-nitrophenolate; 4-nitrobenzene-1,2-diol |
| ?????? ???????? |
C6H5NO4 |
| ????? ??????? ??????? |
155.1082 |
| InChI |
InChI=1/C6H5NO4/c8-5-2-1-4(7(10)11)3-6(5)9/h1-3,8-9H |
| ?????????? ???????? ??????? |
3316-09-4 |
| ???????? ????????? ??? |
222-009-0 |
| ???? ?????? |
|
| ????? |
1.58g/cm3 |
| ???? ???????? |
173-177℃ |
| ???? ??????? |
358.2°C at 760 mmHg |
| ????? ???????? |
1.667 |
| ???? ?????? |
168.8°C |
| ??? ?????? |
1.25E-05mmHg at 25°C |
| ?????? ??? ??????? ?????? |
Xi:Irritant;
|
| ??? ????????? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| ???? ????? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|