ChemNet > CAS > 28788-42-3 Decahydronaphthalene-d18
28788-42-3 Decahydronaphthalene-d18
| ürün Ad? |
Decahydronaphthalene-d18 |
| ingilizce ad? |
Decahydronaphthalene-d18; Decahydronapthalene-d18; (~2~H_18_)decahydronaphthalene |
| Moleküler Formülü |
C10D18 |
| Molekül A??rl??? |
156.3608 |
| InChI |
InChI=1/C10H18/c1-2-6-10-8-4-3-7-9(10)5-1/h9-10H,1-8H2/i1D2,2D2,3D2,4D2,5D2,6D2,7D2,8D2,9D,10D |
| CAS kay?t numaras? |
28788-42-3 |
| Moleküler Yap?s? |
|
| Yo?unluk |
0.986g/cm3 |
| Ergime noktas? |
-32℃ |
| Kaynama noktas? |
190.9°C at 760 mmHg |
| K?r?lma indisi |
1.469 |
| Alevlenme noktas? |
57.2°C |
| Buhar bas?nc? |
0.735mmHg at 25°C |
| Tehlike Sembolleri |
Xi:Irritant;
|
| Risk Kodlar? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik A??klamas? |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|