ChemNet > CAS > 28788-42-3 Decahydronaphthalene-d18
28788-42-3 Decahydronaphthalene-d18
| Nome del prodotto |
Decahydronaphthalene-d18 |
| Nome inglese |
Decahydronaphthalene-d18; Decahydronapthalene-d18; (~2~H_18_)decahydronaphthalene |
| Formula molecolare |
C10D18 |
| Peso Molecolare |
156.3608 |
| InChI |
InChI=1/C10H18/c1-2-6-10-8-4-3-7-9(10)5-1/h9-10H,1-8H2/i1D2,2D2,3D2,4D2,5D2,6D2,7D2,8D2,9D,10D |
| Numero CAS |
28788-42-3 |
| Struttura molecolare |
|
| Densità |
0.986g/cm3 |
| Punto di fusione |
-32℃ |
| Punto di ebollizione |
190.9°C at 760 mmHg |
| Indice di rifrazione |
1.469 |
| Punto d'infiammabilità |
57.2°C |
| Pressione di vapore |
0.735mmHg at 25°C |
| Simboli di pericolo |
Xi:Irritant;
|
| Codici di Rischio |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Sicurezza Descrizione |
S23:Do not inhale gas/fumes/vapour/spray.;
S24/25:Avoid contact with skin and eyes.;
|
|