275-51-4 Azulene
| ürün Ad? |
Azulene |
| ingilizce ad? |
Azulene; Bicyclo[5.3.0]decapentaene; Azunamic; Cyclopentacycloheptene; Bicyclo(5.3.0)-deca-2,4,6,8,10-pentaene; Bicyclo(5.3.0)-1,3,5,7,9-decapentaene; EINECS |
| Moleküler Formülü |
C10H8 |
| Molekül A??rl??? |
128.1705 |
| InChI |
InChI=1/C10H8/c1-2-5-9-7-4-8-10(9)6-3-1/h1-8H |
| CAS kay?t numaras? |
275-51-4 |
| EINECS |
205-993-6 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.037g/cm3 |
| Ergime noktas? |
99-101℃ |
| Kaynama noktas? |
220.7°C at 760 mmHg |
| K?r?lma indisi |
1.632 |
| Alevlenme noktas? |
76.7°C |
| Buhar bas?nc? |
0.165mmHg at 25°C |
| Güvenlik A??klamas? |
S24/25:Avoid contact with skin and eyes.;
|
|