275-51-4 Azulene
| termék neve |
Azulene |
| Angol név |
Azulene; Bicyclo[5.3.0]decapentaene; Azunamic; Cyclopentacycloheptene; Bicyclo(5.3.0)-deca-2,4,6,8,10-pentaene; Bicyclo(5.3.0)-1,3,5,7,9-decapentaene; EINECS |
| MF |
C10H8 |
| Molekulat?meg |
128.1705 |
| InChI |
InChI=1/C10H8/c1-2-5-9-7-4-8-10(9)6-3-1/h1-8H |
| CAS-szám |
275-51-4 |
| EINECS |
205-993-6 |
| Molekuláris szerkezete |
|
| S?r?ség |
1.037g/cm3 |
| Olvadáspont |
99-101℃ |
| Forráspont |
220.7°C at 760 mmHg |
| T?résmutató |
1.632 |
| Gyulladáspont |
76.7°C |
| G?znyomás |
0.165mmHg at 25°C |
| Biztonsági Leírás |
S24/25:Avoid contact with skin and eyes.;
|
|