2439-85-2 N-Bromophthalimide
| ürün Ad? |
N-Bromophthalimide |
| ingilizce ad? |
N-Bromophthalimide;AI3-18212; NSC 3525; 1H-Isoindole-1,3(2H)-dione, 2-bromo-; 2-bromo-1H-isoindole-1,3(2H)-dione |
| Moleküler Formülü |
C8H4BrNO2 |
| Molekül A??rl??? |
226.0269 |
| InChI |
InChI=1/C8H4BrNO2/c9-10-7(11)5-3-1-2-4-6(5)8(10)12/h1-4H |
| CAS kay?t numaras? |
2439-85-2 |
| EINECS |
219-467-9 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.932g/cm3 |
| Ergime noktas? |
199-203℃ |
| Kaynama noktas? |
332.3°C at 760 mmHg |
| K?r?lma indisi |
1.704 |
| Alevlenme noktas? |
154.8°C |
| Buhar bas?nc? |
0.000147mmHg at 25°C |
| Risk Kodlar? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik A??klamas? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|