2439-85-2 N-Bromophthalimide
| product Name |
N-Bromophthalimide |
| CAS No |
2439-85-2 |
| Synonyms |
AI3-18212; NSC 3525; 1H-Isoindole-1,3(2H)-dione, 2-bromo-; 2-bromo-1H-isoindole-1,3(2H)-dione |
| Molecular Formula |
C8H4BrNO2 |
| Molecular Weight |
226.0269 |
| InChI |
InChI=1/C8H4BrNO2/c9-10-7(11)5-3-1-2-4-6(5)8(10)12/h1-4H |
| EINECS |
219-467-9 |
| Molecular Structure |
|
| Density |
1.932g/cm3 |
| Melting point |
199-203℃ |
| Boiling point |
332.3°C at 760 mmHg |
| Refractive index |
1.704 |
| Flash point |
154.8°C |
| Vapour Pressur |
0.000147mmHg at 25°C |
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|