2155-60-4 dibutyl itaconate
| ürün Ad? |
dibutyl itaconate |
| ingilizce ad? |
dibutyl itaconate; Itaconic acid di-n-butyl ester; dibutyl 2-methylidenebutanedioate |
| Moleküler Formülü |
C13H22O4 |
| Molekül A??rl??? |
242.3114 |
| InChI |
InChI=1/C13H22O4/c1-4-6-8-16-12(14)10-11(3)13(15)17-9-7-5-2/h3-10H2,1-2H3 |
| CAS kay?t numaras? |
2155-60-4 |
| EINECS |
218-451-9 |
| Moleküler Yap?s? |
|
| Yo?unluk |
0.989g/cm3 |
| Kaynama noktas? |
307.4°C at 760 mmHg |
| K?r?lma indisi |
1.446 |
| Alevlenme noktas? |
142.2°C |
| Buhar bas?nc? |
0.000728mmHg at 25°C |
| Güvenlik A??klamas? |
S24/25:Avoid contact with skin and eyes.;
|
|