2155-60-4 dibutyl itaconate
| Nome del prodotto |
dibutyl itaconate |
| Nome inglese |
dibutyl itaconate; Itaconic acid di-n-butyl ester; dibutyl 2-methylidenebutanedioate |
| Formula molecolare |
C13H22O4 |
| Peso Molecolare |
242.3114 |
| InChI |
InChI=1/C13H22O4/c1-4-6-8-16-12(14)10-11(3)13(15)17-9-7-5-2/h3-10H2,1-2H3 |
| Numero CAS |
2155-60-4 |
| EINECS |
218-451-9 |
| Struttura molecolare |
|
| Densità |
0.989g/cm3 |
| Punto di ebollizione |
307.4°C at 760 mmHg |
| Indice di rifrazione |
1.446 |
| Punto d'infiammabilità |
142.2°C |
| Pressione di vapore |
0.000728mmHg at 25°C |
| Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
|
|