1222-98-6 4-Nitrochalcone
| ürün Ad? |
4-Nitrochalcone |
| ingilizce ad? |
4-Nitrochalcone; (4-Nitrobenzylidene)acetophenone; 3-(4-nitrophenyl)-1-phenylprop-2-en-1-one; (2E)-3-(4-nitrophenyl)-1-phenylprop-2-en-1-one |
| Moleküler Formülü |
C15H11NO3 |
| Molekül A??rl??? |
253.2527 |
| InChI |
InChI=1/C15H11NO3/c17-15(13-4-2-1-3-5-13)11-8-12-6-9-14(10-7-12)16(18)19/h1-11H/b11-8+ |
| CAS kay?t numaras? |
1222-98-6 |
| EINECS |
214-949-5 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.255g/cm3 |
| Ergime noktas? |
158-160℃ |
| Kaynama noktas? |
399.2°C at 760 mmHg |
| K?r?lma indisi |
1.651 |
| Alevlenme noktas? |
186.5°C |
| Buhar bas?nc? |
1.4E-06mmHg at 25°C |
| Güvenlik A??klamas? |
S24/25:Avoid contact with skin and eyes.;
|
|