1222-98-6 4-Nitrochalcone
| Nome del prodotto |
4-Nitrochalcone |
| Nome inglese |
4-Nitrochalcone; (4-Nitrobenzylidene)acetophenone; 3-(4-nitrophenyl)-1-phenylprop-2-en-1-one; (2E)-3-(4-nitrophenyl)-1-phenylprop-2-en-1-one |
| Formula molecolare |
C15H11NO3 |
| Peso Molecolare |
253.2527 |
| InChI |
InChI=1/C15H11NO3/c17-15(13-4-2-1-3-5-13)11-8-12-6-9-14(10-7-12)16(18)19/h1-11H/b11-8+ |
| Numero CAS |
1222-98-6 |
| EINECS |
214-949-5 |
| Struttura molecolare |
|
| Densità |
1.255g/cm3 |
| Punto di fusione |
158-160℃ |
| Punto di ebollizione |
399.2°C at 760 mmHg |
| Indice di rifrazione |
1.651 |
| Punto d'infiammabilità |
186.5°C |
| Pressione di vapore |
1.4E-06mmHg at 25°C |
| Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
|
|