120-44-5 Desoxyanisoin
| ürün Ad? |
Desoxyanisoin |
| ingilizce ad? |
Desoxyanisoin; 4-Methoxy-2-(4-methoxyphenyl)acetophenone; Desoxyanisoin~4-Methoxybenzyl 4-methoxyphenyl ketone; 4,4-dimethoxydeoxybenzoin; 4-methoxybenzyl 4-methoxyphenyl ketone; Deoxyanisoin; 1,2-bis(4-methoxyphenyl)ethanone |
| Moleküler Formülü |
C16H16O3 |
| Molekül A??rl??? |
256.2964 |
| InChI |
InChI=1/C16H16O3/c1-18-14-7-3-12(4-8-14)11-16(17)13-5-9-15(19-2)10-6-13/h3-10H,11H2,1-2H3 |
| CAS kay?t numaras? |
120-44-5 |
| EINECS |
204-396-8 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.115g/cm3 |
| Ergime noktas? |
109-112℃ |
| Kaynama noktas? |
415.6°C at 760 mmHg |
| K?r?lma indisi |
1.558 |
| Alevlenme noktas? |
196.9°C |
| Buhar bas?nc? |
4.07E-07mmHg at 25°C |
| Güvenlik A??klamas? |
S24/25:Avoid contact with skin and eyes.;
|
|