120-44-5 Desoxyanisoin
| Nama produk |
Desoxyanisoin |
| Nama bahasa Inggris |
Desoxyanisoin; 4-Methoxy-2-(4-methoxyphenyl)acetophenone; Desoxyanisoin~4-Methoxybenzyl 4-methoxyphenyl ketone; 4,4-dimethoxydeoxybenzoin; 4-methoxybenzyl 4-methoxyphenyl ketone; Deoxyanisoin; 1,2-bis(4-methoxyphenyl)ethanone |
| MF |
C16H16O3 |
| Berat Molekul |
256.2964 |
| InChI |
InChI=1/C16H16O3/c1-18-14-7-3-12(4-8-14)11-16(17)13-5-9-15(19-2)10-6-13/h3-10H,11H2,1-2H3 |
| CAS NO |
120-44-5 |
| EINECS |
204-396-8 |
| Struktur Molekul |
|
| Kepadatan |
1.115g/cm3 |
| Titik lebur |
109-112℃ |
| Titik didih |
415.6°C at 760 mmHg |
| Indeks bias |
1.558 |
| Titik nyala |
196.9°C |
| Tekanan uap |
4.07E-07mmHg at 25°C |
| Keselamatan Deskripsi |
S24/25:Avoid contact with skin and eyes.;
|
|