119-52-8 Anisoin
| ürün Ad? |
Anisoin |
| ingilizce ad? |
Anisoin; 4,4-Dimethoxybenzoin; 2-hydroxy-1,2-bis(4-methoxyphenyl)ethanone; (2S)-2-hydroxy-1,2-bis(4-methoxyphenyl)ethanone; (2R)-2-hydroxy-1,2-bis(4-methoxyphenyl)ethanone |
| Moleküler Formülü |
C16H16O4 |
| Molekül A??rl??? |
272.2958 |
| InChI |
InChI=1/C16H16O4/c1-19-13-7-3-11(4-8-13)15(17)16(18)12-5-9-14(20-2)10-6-12/h3-10,15,17H,1-2H3/t15-/m1/s1 |
| CAS kay?t numaras? |
119-52-8 |
| EINECS |
204-330-8 |
| Moleküler Yap?s? |
|
| Yo?unluk |
1.194g/cm3 |
| Ergime noktas? |
109-114℃ |
| Kaynama noktas? |
459.4°C at 760 mmHg |
| K?r?lma indisi |
1.578 |
| Alevlenme noktas? |
171°C |
| Buhar bas?nc? |
3.11E-09mmHg at 25°C |
| Güvenlik A??klamas? |
S24/25:Avoid contact with skin and eyes.;
|
|