119-52-8 Anisoin
| product Name |
Anisoin |
| CAS No |
119-52-8 |
| Synonyms |
4,4-Dimethoxybenzoin; 2-hydroxy-1,2-bis(4-methoxyphenyl)ethanone; (2S)-2-hydroxy-1,2-bis(4-methoxyphenyl)ethanone; (2R)-2-hydroxy-1,2-bis(4-methoxyphenyl)ethanone |
| Molecular Formula |
C16H16O4 |
| Molecular Weight |
272.2958 |
| InChI |
InChI=1/C16H16O4/c1-19-13-7-3-11(4-8-13)15(17)16(18)12-5-9-14(20-2)10-6-12/h3-10,15,17H,1-2H3/t15-/m1/s1 |
| EINECS |
204-330-8 |
| Molecular Structure |
|
| Density |
1.194g/cm3 |
| Melting point |
109-114℃ |
| Boiling point |
459.4°C at 760 mmHg |
| Refractive index |
1.578 |
| Flash point |
171°C |
| Vapour Pressur |
3.11E-09mmHg at 25°C |
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|