110-42-9 Methyl caprate
| ürün Ad? |
Methyl caprate |
| ingilizce ad? |
Methyl caprate; Methyl decanoate; Capric acid methyl ester~Decanoic acid methyl ester~Methyl decanoate; METHYLE N-CAPRINATE |
| Moleküler Formülü |
C11H22O2 |
| Molekül A??rl??? |
186.2912 |
| InChI |
InChI=1/C11H22O2/c1-3-4-5-6-7-8-9-10-11(12)13-2/h3-10H2,1-2H3 |
| CAS kay?t numaras? |
110-42-9 |
| EINECS |
203-766-6 |
| Moleküler Yap?s? |
|
| Yo?unluk |
0.872g/cm3 |
| Ergime noktas? |
-11--14℃ |
| Kaynama noktas? |
224°C at 760 mmHg |
| K?r?lma indisi |
1.426 |
| Alevlenme noktas? |
94.4°C |
| Buhar bas?nc? |
0.0934mmHg at 25°C |
| Güvenlik A??klamas? |
S24/25:Avoid contact with skin and eyes.;
|
|