110-42-9 Methyl caprate
| Nome del prodotto |
Methyl caprate |
| Nome inglese |
Methyl caprate; Methyl decanoate; Capric acid methyl ester~Decanoic acid methyl ester~Methyl decanoate; METHYLE N-CAPRINATE |
| Formula molecolare |
C11H22O2 |
| Peso Molecolare |
186.2912 |
| InChI |
InChI=1/C11H22O2/c1-3-4-5-6-7-8-9-10-11(12)13-2/h3-10H2,1-2H3 |
| Numero CAS |
110-42-9 |
| EINECS |
203-766-6 |
| Struttura molecolare |
|
| Densità |
0.872g/cm3 |
| Punto di fusione |
-11--14℃ |
| Punto di ebollizione |
224°C at 760 mmHg |
| Indice di rifrazione |
1.426 |
| Punto d'infiammabilità |
94.4°C |
| Pressione di vapore |
0.0934mmHg at 25°C |
| Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
|
|