103-78-6 cyclohexylacetone
| ürün Ad? |
cyclohexylacetone |
| ingilizce ad? |
cyclohexylacetone; Cyclohexylacetone, (Acetonylcyclohexane); Acetonylcyclohexane; Cyclohexyacetone; 1-cyclohexylpropan-2-one; 1-cyclohexylacetone |
| Moleküler Formülü |
C9H16O |
| Molekül A??rl??? |
140.2227 |
| InChI |
InChI=1/C9H16O/c1-8(10)7-9-5-3-2-4-6-9/h9H,2-7H2,1H3 |
| CAS kay?t numaras? |
103-78-6 |
| EINECS |
203-143-9 |
| Moleküler Yap?s? |
|
| Yo?unluk |
0.889g/cm3 |
| Kaynama noktas? |
188.1°C at 760 mmHg |
| K?r?lma indisi |
1.441 |
| Alevlenme noktas? |
65.3°C |
| Buhar bas?nc? |
0.609mmHg at 25°C |
| Güvenlik A??klamas? |
S24/25:Avoid contact with skin and eyes.;
|
|