103-78-6 cyclohexylacetone
| Nama produk |
cyclohexylacetone |
| Nama Inggeris |
cyclohexylacetone; Cyclohexylacetone, (Acetonylcyclohexane); Acetonylcyclohexane; Cyclohexyacetone; 1-cyclohexylpropan-2-one; 1-cyclohexylacetone |
| MF |
C9H16O |
| Berat Molekul |
140.2227 |
| InChI |
InChI=1/C9H16O/c1-8(10)7-9-5-3-2-4-6-9/h9H,2-7H2,1H3 |
| CAS NO |
103-78-6 |
| EINECS |
203-143-9 |
| Struktur Molekul |
|
| Kepadatan |
0.889g/cm3 |
| Titik didih |
188.1°C at 760 mmHg |
| Indeks bias |
1.441 |
| Titik nyala |
65.3°C |
| Tekanan wap |
0.609mmHg at 25°C |
| Keselamatan Penerangan |
S24/25:Avoid contact with skin and eyes.;
|
|