818-88-2 mono-methyl sebacate
| ??? ?????? |
mono-methyl sebacate |
| ????? ??????????? |
mono-methyl sebacate; Monomethyl sebacate~Sebacic acid monomethyl ester; Sebacic acid monomethyl ester; Methyl hydrogen sebacate (Monomethyl sebacate; Sebacic acid monomethyl ester); monomethyl sebacate; 10-methoxy-10-oxodecanoic acid |
| ?????? ???????? |
C11H20O4 |
| ????? ??????? ??????? |
216.2741 |
| InChI |
InChI=1/C11H20O4/c1-15-11(14)9-7-5-3-2-4-6-8-10(12)13/h2-9H2,1H3,(H,12,13) |
| ?????????? ???????? ??????? |
818-88-2 |
| ???????? ????????? ??? |
212-458-0 |
| ???? ?????? |
|
| ????? |
1.038g/cm3 |
| ???? ???????? |
41-44℃ |
| ???? ??????? |
332.5°C at 760 mmHg |
| ????? ???????? |
1.453 |
| ???? ?????? |
115.4°C |
| ??? ?????? |
2.8E-05mmHg at 25°C |
| ???? ????? |
S24/25:Avoid contact with skin and eyes.;
|
|