818-88-2 mono-methyl sebacate
| Nom |
mono-methyl sebacate |
| Nom anglais |
mono-methyl sebacate; Monomethyl sebacate~Sebacic acid monomethyl ester; Sebacic acid monomethyl ester; Methyl hydrogen sebacate (Monomethyl sebacate; Sebacic acid monomethyl ester); monomethyl sebacate; 10-methoxy-10-oxodecanoic acid |
| Formule moléculaire |
C11H20O4 |
| Poids Moléculaire |
216.2741 |
| InChI |
InChI=1/C11H20O4/c1-15-11(14)9-7-5-3-2-4-6-8-10(12)13/h2-9H2,1H3,(H,12,13) |
| Numéro de registre CAS |
818-88-2 |
| EINECS |
212-458-0 |
| Structure moléculaire |
|
| Densité |
1.038g/cm3 |
| Point de fusion |
41-44℃ |
| Point d'ébullition |
332.5°C at 760 mmHg |
| Indice de réfraction |
1.453 |
| Point d'éclair |
115.4°C |
| Pression de vapeur |
2.8E-05mmHg at 25°C |
| Description de sécurité |
S24/25:Avoid contact with skin and eyes.;
|
|