719-60-8 Pentafluorocinnamic acid
| ??? ?????? |
Pentafluorocinnamic acid |
| ????? ??????????? |
Pentafluorocinnamic acid; 2,3,4,5,6-Pentafluorocinnamic acid; (2E)-3-(pentafluorophenyl)prop-2-enoate; (2E)-3-(pentafluorophenyl)prop-2-enoic acid; 3-(pentafluorophenyl)prop-2-enoate |
| ?????? ???????? |
C9H2F5O2 |
| ????? ??????? ??????? |
237.1035 |
| InChI |
InChI=1/C9H3F5O2/c10-5-3(1-2-4(15)16)6(11)8(13)9(14)7(5)12/h1-2H,(H,15,16)/p-1 |
| ?????????? ???????? ??????? |
719-60-8 |
| ???? ?????? |
|
| ???? ???????? |
152-156℃ |
| ???? ??????? |
251.5°C at 760 mmHg |
| ???? ?????? |
105.9°C |
| ??? ?????? |
0.0106mmHg at 25°C |
| ?????? ??? ??????? ?????? |
Xi:Irritant;
|
| ??? ????????? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| ???? ????? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|