719-60-8 Pentafluorocinnamic acid
| Ονομασ?α του προ??ντο? |
Pentafluorocinnamic acid |
| Αγγλικ? ?νομα |
Pentafluorocinnamic acid; 2,3,4,5,6-Pentafluorocinnamic acid; (2E)-3-(pentafluorophenyl)prop-2-enoate; (2E)-3-(pentafluorophenyl)prop-2-enoic acid; 3-(pentafluorophenyl)prop-2-enoate |
| MF |
C9H2F5O2 |
| Μοριακ? β?ρο? |
237.1035 |
| InChI |
InChI=1/C9H3F5O2/c10-5-3(1-2-4(15)16)6(11)8(13)9(14)7(5)12/h1-2H,(H,15,16)/p-1 |
| CAS ΟΧΙ |
719-60-8 |
| Μοριακ? δομ? |
|
| Σημε?ο τ?ξη? |
152-156℃ |
| Σημε?ο βρασμο? |
251.5°C at 760 mmHg |
| Σημε?ο αν?φλεξη? |
105.9°C |
| Π?εση ατμ?ν |
0.0106mmHg at 25°C |
| Σ?μβολα επικινδυν?τητα? |
Xi:Irritant;
|
| Κινδ?νου Κ?δικε? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Περιγραφ? τη? ασφ?λεια? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|