ChemNet > CAS > 602-00-6 3-Hydroxy-2-nitrobenzoic acid
602-00-6 3-Hydroxy-2-nitrobenzoic acid
| ??? ?????? |
3-Hydroxy-2-nitrobenzoic acid |
| ????? ??????????? |
3-Hydroxy-2-nitrobenzoic acid; |
| ?????? ???????? |
C7H5NO5 |
| ????? ??????? ??????? |
183.1183 |
| InChI |
InChI=1/C7H5NO5/c9-5-3-1-2-4(7(10)11)6(5)8(12)13/h1-3,9H,(H,10,11) |
| ?????????? ???????? ??????? |
602-00-6 |
| ???? ?????? |
|
| ????? |
1.631g/cm3 |
| ???? ??????? |
362.9°C at 760 mmHg |
| ????? ???????? |
1.663 |
| ???? ?????? |
166.7°C |
| ??? ?????? |
6.68E-06mmHg at 25°C |
| ??? ????????? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| ???? ????? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|