ChemNet > CAS > 602-00-6 3-Hydroxy-2-nitrobenzoic acid
602-00-6 3-Hydroxy-2-nitrobenzoic acid
| ?????? ?? ??? |
3-Hydroxy-2-nitrobenzoic acid |
| ???????? ??? |
3-Hydroxy-2-nitrobenzoic acid; |
| ????? ???????? |
C7H5NO5 |
| ?????? ??? |
183.1183 |
| InChI |
InChI=1/C7H5NO5/c9-5-3-1-2-4(7(10)11)6(5)8(12)13/h1-3,9H,(H,10,11) |
| ??? ??????? ?????? |
602-00-6 |
| ????? ?????? |
|
| ????? |
1.631g/cm3 |
| ????? ?? ??? |
362.9°C at 760 mmHg |
| ??????? ??????? |
1.663 |
| ????? ??????? |
166.7°C |
| ????? ?? ???? |
6.68E-06mmHg at 25°C |
| ???? ?? ??? |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| ??????? ????? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|