102-85-2 Tributyl phosphite
| ??? ?????? |
Tributyl phosphite |
| ????? ??????????? |
Tributyl phosphite; Tri-n-butyl phosphite |
| ?????? ???????? |
C12H27O3P |
| ????? ??????? ??????? |
250.3147 |
| InChI |
InChI=1/C12H27O3P/c1-4-7-10-13-16(14-11-8-5-2)15-12-9-6-3/h4-12H2,1-3H3 |
| ?????????? ???????? ??????? |
102-85-2 |
| ???????? ????????? ??? |
203-061-3 |
| ???? ?????? |
|
| ???? ???????? |
-80℃ |
| ???? ??????? |
268.1°C at 760 mmHg |
| ???? ?????? |
121.1°C |
| ??? ?????? |
0.013mmHg at 25°C |
| ?????? ??? ??????? ?????? |
Xn:Harmful;
|
| ??? ????????? |
R21:Harmful in contact with skin.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| ???? ????? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|