102-85-2 Tributyl phosphite
| Ονομασ?α του προ??ντο? |
Tributyl phosphite |
| Αγγλικ? ?νομα |
Tributyl phosphite; Tri-n-butyl phosphite |
| MF |
C12H27O3P |
| Μοριακ? β?ρο? |
250.3147 |
| InChI |
InChI=1/C12H27O3P/c1-4-7-10-13-16(14-11-8-5-2)15-12-9-6-3/h4-12H2,1-3H3 |
| CAS ΟΧΙ |
102-85-2 |
| EINECS |
203-061-3 |
| Μοριακ? δομ? |
|
| Σημε?ο τ?ξη? |
-80℃ |
| Σημε?ο βρασμο? |
268.1°C at 760 mmHg |
| Σημε?ο αν?φλεξη? |
121.1°C |
| Π?εση ατμ?ν |
0.013mmHg at 25°C |
| Σ?μβολα επικινδυν?τητα? |
Xn:Harmful;
|
| Κινδ?νου Κ?δικε? |
R21:Harmful in contact with skin.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Περιγραφ? τη? ασφ?λεια? |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|