ChemNet > CAS > 9002-83-9 poly(chlorotrifluoroethylene)
9002-83-9 poly(chlorotrifluoroethylene)
| Название продукта |
poly(chlorotrifluoroethylene) |
| Английское название |
poly(chlorotrifluoroethylene); halocarbon oil 27 insect cell*culture tested; Fluorolube grease; PCTFE; Fluorolube Grease, Gr-362 |
| Молекулярная формула |
C2ClF3 |
| Молекулярный вес |
116.4693 |
| InChI |
InChI=1/C2ClF3/c3-1(4)2(5)6 |
| Регистрационный номер CAS |
9002-83-9 |
| Молекулярная структура |
|
| Плотность |
1.9 |
| Температура плавления |
210℃ |
| Характеристики безопасности |
S24/25:Avoid contact with skin and eyes.;
|
|