ChemNet > CAS > 9002-83-9 poly(chlorotrifluoroethylene)
9002-83-9 poly(chlorotrifluoroethylene)
| Nome do produto |
poly(chlorotrifluoroethylene) |
| Nome em inglês |
poly(chlorotrifluoroethylene); halocarbon oil 27 insect cell*culture tested; Fluorolube grease; PCTFE; Fluorolube Grease, Gr-362 |
| Fórmula molecular |
C2ClF3 |
| Peso Molecular |
116.4693 |
| InChI |
InChI=1/C2ClF3/c3-1(4)2(5)6 |
| CAS Registry Number |
9002-83-9 |
| Estrutura Molecular |
|
| Densidade |
1.9 |
| Ponto de fus?o |
210℃ |
| Descri??o da Seguran?a |
S24/25:Avoid contact with skin and eyes.;
|
|