885-82-5 Nitrophenylphenol
| Nome do produto |
Nitrophenylphenol |
| Nome em inglês |
Nitrophenylphenol; 4-Hydroxy-3-Nitrodiphenyl; 3-nitrobiphenyl-4-ol |
| Fórmula molecular |
C12H9NO3 |
| Peso Molecular |
215.2048 |
| InChI |
InChI=1/C12H9NO3/c14-12-7-6-10(8-11(12)13(15)16)9-4-2-1-3-5-9/h1-8,14H |
| CAS Registry Number |
885-82-5 |
| EINECS |
212-946-3 |
| Estrutura Molecular |
|
| Densidade |
1.304g/cm3 |
| Ponto de ebuli??o |
338.5°C at 760 mmHg |
| índice de refra??o |
1.637 |
| O ponto de inflama??o |
145.1°C |
| Press?o de vapor |
4.98E-05mmHg at 25°C |
| Códigos de risco |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Descri??o da Seguran?a |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|