885-82-5 Nitrophenylphenol
| Naam product |
Nitrophenylphenol |
| Engelse naam |
Nitrophenylphenol; 4-Hydroxy-3-Nitrodiphenyl; 3-nitrobiphenyl-4-ol |
| MF |
C12H9NO3 |
| Molecuulgewicht |
215.2048 |
| InChI |
InChI=1/C12H9NO3/c14-12-7-6-10(8-11(12)13(15)16)9-4-2-1-3-5-9/h1-8,14H |
| CAS-nummer |
885-82-5 |
| EINECS |
212-946-3 |
| Moleculaire Structuur |
|
| Dichtheid |
1.304g/cm3 |
| Kookpunt |
338.5°C at 760 mmHg |
| Brekingsindex |
1.637 |
| Vlampunt |
145.1°C |
| Dampdruk |
4.98E-05mmHg at 25°C |
| Risico-codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Veiligheid Omschrijving |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|