818-38-2 diethyl glutarate
| Nome do produto |
diethyl glutarate |
| Nome em inglês |
diethyl glutarate; Diethyl glutarate, (Glutaric acid diethyl ester); Glutaric acid diethyl ester; Diethyl Pentanediate; diethyl pentanedioate |
| Fórmula molecular |
C9H16O4 |
| Peso Molecular |
188.2209 |
| InChI |
InChI=1/C9H16O4/c1-3-12-8(10)6-5-7-9(11)13-4-2/h3-7H2,1-2H3 |
| CAS Registry Number |
818-38-2 |
| EINECS |
212-451-2 |
| Estrutura Molecular |
|
| Densidade |
1.022g/cm3 |
| Ponto de ebuli??o |
236.5°C at 760 mmHg |
| índice de refra??o |
1.427 |
| O ponto de inflama??o |
96.1°C |
| Press?o de vapor |
0.0472mmHg at 25°C |
| Descri??o da Seguran?a |
S24/25:Avoid contact with skin and eyes.;
|
|