818-38-2 diethyl glutarate
| product Name |
diethyl glutarate |
| CAS No |
818-38-2 |
| Synonyms |
Diethyl glutarate, (Glutaric acid diethyl ester); Glutaric acid diethyl ester; Diethyl Pentanediate; diethyl pentanedioate |
| Molecular Formula |
C9H16O4 |
| Molecular Weight |
188.2209 |
| InChI |
InChI=1/C9H16O4/c1-3-12-8(10)6-5-7-9(11)13-4-2/h3-7H2,1-2H3 |
| EINECS |
212-451-2 |
| Molecular Structure |
|
| Density |
1.022g/cm3 |
| Boiling point |
236.5°C at 760 mmHg |
| Refractive index |
1.427 |
| Flash point |
96.1°C |
| Vapour Pressur |
0.0472mmHg at 25°C |
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
Featured China Suppliers
| Contact |
Mr. Wei Fei ( Managing Director) Mrs. Lanny Cao ( Director) |
| Telephone |
+86-571-85232125;85232161;85134551 |
| Email |
info@afinechem.com;sales@afinechem.com |
| Address |
7-601 ,Xigang Xinjie, Xihu Industrial Park, Sandun Town,Hangzhou 310030, China |
| Contact |
Mr. Zheng |
| Telephone |
+86-592-2299609 |
| Email |
chem@chemtrade.cn |
| Address |
No. 8 Songyu Road, Xiamen, Fujian, China |
| Contact |
Shirley/Maddie |
| Telephone |
+86-15275461299/86-18562558750 |
| Email |
sales01@bluewaterchem.com |
| Address |
Rm 309A-1, China(Guangrao)Urban Empowderment Center, NO.817 Bingsheng Road, Guangrao County, Dongying City, Shandong Province, China. |