ChemNet > CAS > 771-56-2 methyl pentafluorobenzene
771-56-2 methyl pentafluorobenzene
| Nome do produto |
methyl pentafluorobenzene |
| Nome em inglês |
methyl pentafluorobenzene; 2,3,4,5,6-Pentafluorotoluene; Methylpentafluorobenzene |
| Fórmula molecular |
C7H3F5 |
| Peso Molecular |
182.09 |
| InChI |
InChI=1/C7H3F5/c1-2-3(8)5(10)7(12)6(11)4(2)9/h1H3 |
| CAS Registry Number |
771-56-2 |
| EINECS |
212-233-7 |
| Estrutura Molecular |
|
| Densidade |
1.44 |
| Ponto de ebuli??o |
117℃ |
| Códigos de risco |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Descri??o da Seguran?a |
S23:Do not inhale gas/fumes/vapour/spray.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|