ChemNet > CAS > 771-56-2 methyl pentafluorobenzene
771-56-2 methyl pentafluorobenzene
| Nazwa produktu: |
methyl pentafluorobenzene |
| Angielska nazwa |
methyl pentafluorobenzene; 2,3,4,5,6-Pentafluorotoluene; Methylpentafluorobenzene |
| MF |
C7H3F5 |
| Masie cz?steczkowej |
182.09 |
| InChI |
InChI=1/C7H3F5/c1-2-3(8)5(10)7(12)6(11)4(2)9/h1H3 |
| Nr CAS |
771-56-2 |
| EINECS |
212-233-7 |
| Struktury molekularnej |
|
| G?sto?? |
1.44 |
| Temperatura wrzenia |
117℃ |
| Kody ryzyka |
R10:Flammable.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Bezpieczeństwo opis |
S23:Do not inhale gas/fumes/vapour/spray.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|