77-04-3 Pyrithyldione
| Nome do produto |
Pyrithyldione |
| Nome em inglês |
Pyrithyldione; 3,3-Diethyl-2,4(1H,3H)-pyridinedione; 3,3-diethylpyridine-2,4(1H,3H)-dione |
| Fórmula molecular |
C9H13NO2 |
| Peso Molecular |
167.205 |
| InChI |
InChI=1/C9H13NO2/c1-3-9(4-2)7(11)5-6-10-8(9)12/h5-6H,3-4H2,1-2H3,(H,10,12) |
| CAS Registry Number |
77-04-3 |
| EINECS |
201-000-5 |
| Estrutura Molecular |
|
| Densidade |
1.029g/cm3 |
| Ponto de ebuli??o |
330.2°C at 760 mmHg |
| índice de refra??o |
1.464 |
| O ponto de inflama??o |
147.8°C |
| Press?o de vapor |
0.000169mmHg at 25°C |
| Símbolos de perigo |
Xn:Harmful;
|
| Códigos de risco |
R20/21:Harmful by inhalation and in contact with skin.;
|
| Descri??o da Seguran?a |
S23:Do not inhale gas/fumes/vapour/spray.;
|
|