77-04-3 Pyrithyldione
| název vyrobku |
Pyrithyldione |
| Anglicky název |
Pyrithyldione; 3,3-Diethyl-2,4(1H,3H)-pyridinedione; 3,3-diethylpyridine-2,4(1H,3H)-dione |
| Molekulární vzorec |
C9H13NO2 |
| Molekulová hmotnost |
167.205 |
| InChI |
InChI=1/C9H13NO2/c1-3-9(4-2)7(11)5-6-10-8(9)12/h5-6H,3-4H2,1-2H3,(H,10,12) |
| Registra?ní ?íslo CAS |
77-04-3 |
| EINECS |
201-000-5 |
| Molekulární struktura |
|
| Hustota |
1.029g/cm3 |
| Bod varu |
330.2°C at 760 mmHg |
| Index lomu |
1.464 |
| Bod vzplanutí |
147.8°C |
| Tlak par |
0.000169mmHg at 25°C |
| Symbol? nebezpe?nosti |
Xn:Harmful;
|
| Riziko Codes |
R20/21:Harmful by inhalation and in contact with skin.;
|
| Bezpe?nostní Popis |
S23:Do not inhale gas/fumes/vapour/spray.;
|
|