758-12-3 Acetic acid-d
| Nome do produto |
Acetic acid-d |
| Nome em inglês |
Acetic acid-d; Acetic acid-d1; acetate; (O-~2~H)acetic acid; Acetic acid-OD |
| Fórmula molecular |
C2H3DO2 |
| Peso Molecular |
61.0581 |
| InChI |
InChI=1/C2H4O2/c1-2(3)4/h1H3,(H,3,4)/i/hD |
| CAS Registry Number |
758-12-3 |
| EINECS |
212-059-1 |
| Estrutura Molecular |
|
| Densidade |
1.086g/cm3 |
| Ponto de fus?o |
15-16℃ |
| Ponto de ebuli??o |
117.1°C at 760 mmHg |
| índice de refra??o |
1.375 |
| O ponto de inflama??o |
40°C |
| Press?o de vapor |
13.9mmHg at 25°C |
| Símbolos de perigo |
C:Corrosive;
|
| Códigos de risco |
R10:Flammable.;
R35:Causes severe burns.;
|
| Descri??o da Seguran?a |
S23:Do not inhale gas/fumes/vapour/spray.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|