758-12-3 Acetic acid-d
| ???? |
Acetic acid-d |
| ?? ?? |
Acetic acid-d; Acetic acid-d1; acetate; (O-~2~H)acetic acid; Acetic acid-OD |
| ??? |
C2H3DO2 |
| ??? |
61.0581 |
| InChI |
InChI=1/C2H4O2/c1-2(3)4/h1H3,(H,3,4)/i/hD |
| cas?? |
758-12-3 |
| EC?? |
212-059-1 |
| ?? ?? |
|
| ?? |
1.086g/cm3 |
| ?? ? |
15-16℃ |
| ??? |
117.1°C at 760 mmHg |
| ?? ?? |
1.375 |
| ??? |
40°C |
| ??? |
13.9mmHg at 25°C |
| ??? ?? |
C:Corrosive;
|
| ??? ?? |
R10:Flammable.;
R35:Causes severe burns.;
|
| ?? ?? |
S23:Do not inhale gas/fumes/vapour/spray.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|