644-13-3 2'-benzonaphthone
| Nome do produto |
2'-benzonaphthone |
| Nome em inglês |
2'-benzonaphthone;Methanone, 2-naphthalenylphenyl-; 2-Benzonaphthone; 2-Benzoylnaphthalene; 2-Naphthyl phenyl ketone; Ketone, 2-naphthyl phenyl; NSC 5190; beta-Benzoylnaphthalene; 2'-Benzonaphthone; naphthalen-2-yl(phenyl)methanone |
| Fórmula molecular |
C17H12O |
| Peso Molecular |
232.2766 |
| InChI |
InChI=1/C17H12O/c18-17(14-7-2-1-3-8-14)16-11-10-13-6-4-5-9-15(13)12-16/h1-12H |
| CAS Registry Number |
644-13-3 |
| EINECS |
211-410-6 |
| Estrutura Molecular |
|
| Densidade |
1.151g/cm3 |
| Ponto de fus?o |
76-82℃ |
| Ponto de ebuli??o |
384.1°C at 760 mmHg |
| índice de refra??o |
1.653 |
| O ponto de inflama??o |
174.7°C |
| Press?o de vapor |
4.2E-06mmHg at 25°C |
| Símbolos de perigo |
Xi:Irritant;
|
| Códigos de risco |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Descri??o da Seguran?a |
S24/25:Avoid contact with skin and eyes.;
|
|