644-13-3 2'-benzonaphthone
| Produkt-Name |
2'-benzonaphthone |
| Englischer Name |
2'-benzonaphthone;Methanone, 2-naphthalenylphenyl-; 2-Benzonaphthone; 2-Benzoylnaphthalene; 2-Naphthyl phenyl ketone; Ketone, 2-naphthyl phenyl; NSC 5190; beta-Benzoylnaphthalene; 2'-Benzonaphthone; naphthalen-2-yl(phenyl)methanone |
| Molekulare Formel |
C17H12O |
| Molecular Weight |
232.2766 |
| InChI |
InChI=1/C17H12O/c18-17(14-7-2-1-3-8-14)16-11-10-13-6-4-5-9-15(13)12-16/h1-12H |
| CAS Registry Number |
644-13-3 |
| EINECS |
211-410-6 |
| Molecular Structure |
|
| Dichte |
1.151g/cm3 |
| Schmelzpunkt |
76-82℃ |
| Siedepunkt |
384.1°C at 760 mmHg |
| Brechungsindex |
1.653 |
| Flammpunkt |
174.7°C |
| Dampfdruck |
4.2E-06mmHg at 25°C |
| Gefahrensymbole |
Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Beschreibung |
S24/25:Avoid contact with skin and eyes.;
|
|