644-06-4 Precocene II
| Nome do produto |
Precocene II |
| Nome em inglês |
Precocene II; 6,7-Dimethoxy-2,2-dimethyl-3-chromene; 6,7-dimethoxy-2,2-dimethyl-2H-chromene |
| Fórmula molecular |
C13H16O3 |
| Peso Molecular |
220.2643 |
| InChI |
InChI=1/C13H16O3/c1-13(2)6-5-9-7-11(14-3)12(15-4)8-10(9)16-13/h5-8H,1-4H3 |
| CAS Registry Number |
644-06-4 |
| EINECS |
211-408-5 |
| Estrutura Molecular |
|
| Densidade |
1.063g/cm3 |
| Ponto de fus?o |
44-47℃ |
| Ponto de ebuli??o |
300.4°C at 760 mmHg |
| índice de refra??o |
1.513 |
| O ponto de inflama??o |
100°C |
| Press?o de vapor |
0.00201mmHg at 25°C |
| Descri??o da Seguran?a |
S24/25:Avoid contact with skin and eyes.;
|
|