644-06-4 Precocene II
| product Name |
Precocene II |
| CAS No |
644-06-4 |
| Synonyms |
6,7-Dimethoxy-2,2-dimethyl-3-chromene; 6,7-dimethoxy-2,2-dimethyl-2H-chromene |
| Molecular Formula |
C13H16O3 |
| Molecular Weight |
220.2643 |
| InChI |
InChI=1/C13H16O3/c1-13(2)6-5-9-7-11(14-3)12(15-4)8-10(9)16-13/h5-8H,1-4H3 |
| EINECS |
211-408-5 |
| Molecular Structure |
|
| Density |
1.063g/cm3 |
| Melting point |
44-47℃ |
| Boiling point |
300.4°C at 760 mmHg |
| Refractive index |
1.513 |
| Flash point |
100°C |
| Vapour Pressur |
0.00201mmHg at 25°C |
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
| MSDS |
Material Safety Data Sheet
|
|