643-28-7 2-Isopropylaniline
| Nome do produto |
2-Isopropylaniline |
| Nome em inglês |
2-Isopropylaniline; 2-Aminocumene; 2-(1-methylethyl)-benzenamine; 2-(propan-2-yl)aniline |
| Fórmula molecular |
C9H13N |
| Peso Molecular |
135.2062 |
| InChI |
InChI=1/C9H13N/c1-7(2)8-5-3-4-6-9(8)10/h3-7H,10H2,1-2H3 |
| CAS Registry Number |
643-28-7 |
| EINECS |
211-397-7 |
| Estrutura Molecular |
|
| Densidade |
0.953g/cm3 |
| Ponto de ebuli??o |
225.6°C at 760 mmHg |
| índice de refra??o |
1.542 |
| O ponto de inflama??o |
95.6°C |
| Press?o de vapor |
0.0858mmHg at 25°C |
| Símbolos de perigo |
Xn:Harmful;
|
| Códigos de risco |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Descri??o da Seguran?a |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
|
|