643-28-7 2-Isopropylaniline
| ?? ????? |
2-Isopropylaniline |
| ?? ????? |
2-Isopropylaniline; 2-Aminocumene; 2-(1-methylethyl)-benzenamine; 2-(propan-2-yl)aniline |
| ????????? ??????? |
C9H13N |
| ???? ???????? |
135.2062 |
| InChI |
InChI=1/C9H13N/c1-7(2)8-5-3-4-6-9(8)10/h3-7H,10H2,1-2H3 |
| ???? CAS |
643-28-7 |
| EINECS |
211-397-7 |
| ???? ???????? |
|
| ?????? |
0.953g/cm3 |
| ????? ????? |
225.6°C at 760 mmHg |
| ???? ????? |
1.542 |
| ????? ???? |
95.6°C |
| ??? ???? |
0.0858mmHg at 25°C |
| Hazard ?????? |
Xn:Harmful;
|
| ??????? ???? |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| ?????? ????? |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
|
|