611-23-4 2-Nitrosotoluene
| Nome do produto |
2-Nitrosotoluene |
| Nome em inglês |
2-Nitrosotoluene;1-Methyl-2-nitrosobenzene; 2-Methyl-1-nitrosobenzene; 2-Methylnitrosobenzene; 4-05-00-00844 (Beilstein Handbook Reference); BRN 1927295; CCRIS 480; NSC 66507; o-Methylnitrosobenzene; o-Nitrosotoluene; Benzene, 1-methyl-2-nitroso- (9CI); Toluene, o-nitroso- |
| Fórmula molecular |
C7H7NO |
| Peso Molecular |
121.1366 |
| InChI |
InChI=1/C7H7NO/c1-6-4-2-3-5-7(6)8-9/h2-5H,1H3 |
| CAS Registry Number |
611-23-4 |
| EINECS |
210-261-4 |
| Estrutura Molecular |
|
| Densidade |
1.03g/cm3 |
| Ponto de fus?o |
70-75℃ |
| Ponto de ebuli??o |
199.9°C at 760 mmHg |
| índice de refra??o |
1.524 |
| O ponto de inflama??o |
74.7°C |
| Press?o de vapor |
0.472mmHg at 25°C |
| Descri??o da Seguran?a |
S24/25:Avoid contact with skin and eyes.;
|
|