611-23-4 2-Nitrosotoluene
| Naam product |
2-Nitrosotoluene |
| Engelse naam |
2-Nitrosotoluene;1-Methyl-2-nitrosobenzene; 2-Methyl-1-nitrosobenzene; 2-Methylnitrosobenzene; 4-05-00-00844 (Beilstein Handbook Reference); BRN 1927295; CCRIS 480; NSC 66507; o-Methylnitrosobenzene; o-Nitrosotoluene; Benzene, 1-methyl-2-nitroso- (9CI); Toluene, o-nitroso- |
| MF |
C7H7NO |
| Molecuulgewicht |
121.1366 |
| InChI |
InChI=1/C7H7NO/c1-6-4-2-3-5-7(6)8-9/h2-5H,1H3 |
| CAS-nummer |
611-23-4 |
| EINECS |
210-261-4 |
| Moleculaire Structuur |
|
| Dichtheid |
1.03g/cm3 |
| Smeltpunt |
70-75℃ |
| Kookpunt |
199.9°C at 760 mmHg |
| Brekingsindex |
1.524 |
| Vlampunt |
74.7°C |
| Dampdruk |
0.472mmHg at 25°C |
| Veiligheid Omschrijving |
S24/25:Avoid contact with skin and eyes.;
|
|