610-34-4 Ethyl 2-nitrobenzoate
| Nome do produto |
Ethyl 2-nitrobenzoate |
| Nome em inglês |
Ethyl 2-nitrobenzoate; 2-Nitrobenzoic acid ethyl ester |
| Fórmula molecular |
C9H9NO4 |
| Peso Molecular |
195.1721 |
| InChI |
InChI=1/C9H9NO4/c1-2-14-9(11)7-5-3-4-6-8(7)10(12)13/h3-6H,2H2,1H3 |
| CAS Registry Number |
610-34-4 |
| EINECS |
210-220-0 |
| Estrutura Molecular |
|
| Densidade |
1.253g/cm3 |
| Ponto de fus?o |
26-174℃ |
| Ponto de ebuli??o |
275°C at 760 mmHg |
| índice de refra??o |
1.544 |
| O ponto de inflama??o |
126.1°C |
| Press?o de vapor |
0.00523mmHg at 25°C |
| Descri??o da Seguran?a |
S24/25:Avoid contact with skin and eyes.;
|
|