610-34-4 Ethyl 2-nitrobenzoate
| Nome del prodotto |
Ethyl 2-nitrobenzoate |
| Nome inglese |
Ethyl 2-nitrobenzoate; 2-Nitrobenzoic acid ethyl ester |
| Formula molecolare |
C9H9NO4 |
| Peso Molecolare |
195.1721 |
| InChI |
InChI=1/C9H9NO4/c1-2-14-9(11)7-5-3-4-6-8(7)10(12)13/h3-6H,2H2,1H3 |
| Numero CAS |
610-34-4 |
| EINECS |
210-220-0 |
| Struttura molecolare |
|
| Densità |
1.253g/cm3 |
| Punto di fusione |
26-174℃ |
| Punto di ebollizione |
275°C at 760 mmHg |
| Indice di rifrazione |
1.544 |
| Punto d'infiammabilità |
126.1°C |
| Pressione di vapore |
0.00523mmHg at 25°C |
| Sicurezza Descrizione |
S24/25:Avoid contact with skin and eyes.;
|
|